About 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one
3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one (PubChem CID 91412316) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one |
| PubChem CID | 91412316 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one |
| SMILES | COCCN(CCOC)C1=CC(=O)NC1 |
| InChI | InChI=1S/C10H18N2O3/c1-14-5-3-12(4-6-15-2)9-7-10(13)11-8-9/h7H,3-6,8H2,1-2H3,(H,11,13) |
| InChIKey | XIOGFADVKGFEAB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one (CID 91412316) is 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one is COCCN(CCOC)C1=CC(=O)NC1.
What is the InChIKey of 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one?
The InChIKey is XIOGFADVKGFEAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-14-5-3-12(4-6-15-2)9-7-10(13)11-8-9/h7H,3-6,8H2,1-2H3,(H,11,13).
What are the key properties of 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one?
3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one has a molecular weight of 214.26 g/mol, XLogP of -0.41, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(2-methoxyethyl)amino]-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 91412316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).