C20H32BN8+ — CID 91412754
N,2-bis(aminomethylidene)-3,4-diethyl-N',3,4-trimethyl-1-methylimino-[1,5,2]diazaborinino[1,2-a][1,3,2]benzodiazaborol-2-ium-6-carboximidamide (PubChem CID 91412754) has the molecular formula C20H32BN8+ and a molecular weight of 395.34 g/mol. Its IUPAC name is N,2-bis(aminomethylidene)-3,4-diethyl-N',3,4-trimethyl-1-methylimino-[1,5,2]diazaborinino[1,2-a][1,3,2]benzodiazaborol-2-ium-6-carboximidamide.
| Compound Name | N,2-bis(aminomethylidene)-3,4-diethyl-N',3,4-trimethyl-1-methylimino-[1,5,2]diazaborinino[1,2-a][1,3,2]benzodiazaborol-2-ium-6-carboximidamide |
|---|---|
| PubChem CID | 91412754 |
| Molecular Formula | C20H32BN8+ |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N,2-bis(aminomethylidene)-3,4-diethyl-N',3,4-trimethyl-1-methylimino-[1,5,2]diazaborinino[1,2-a][1,3,2]benzodiazaborol-2-ium-6-carboximidamide |
| SMILES | CCC1(C)B2N(/C(N=CN)=N/C)c3ccccc3N2/C(=N\C)[N+](=CN)C1(C)CC |
| InChI | InChI=1S/C20H31BN8/c1-7-19(3)20(4,8-2)27(14-23)18(25-6)29-16-12-10-9-11-15(16)28(21(19)29)17(24-5)26-13-22/h9-14,23H,7-8H2,1-6H3,(H2,22,24,26)/p+1/b25-18- |
| InChIKey | DDOCLPBZOPDKGA-BWAHOGKJSA-O |
| XLogP | 2.11 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|