C19H21BrO4 — CID 91412791
2'-(2-bromo-4,6-dimethylphenyl)spiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-indene]-1',3'-dione (PubChem CID 91412791) has the molecular formula C19H21BrO4 and a molecular weight of 393.28 g/mol. Its IUPAC name is 2'-(2-bromo-4,6-dimethylphenyl)spiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-indene]-1',3'-dione.
| Compound Name | 2'-(2-bromo-4,6-dimethylphenyl)spiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-indene]-1',3'-dione |
|---|---|
| PubChem CID | 91412791 |
| Molecular Formula | C19H21BrO4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2'-(2-bromo-4,6-dimethylphenyl)spiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-indene]-1',3'-dione |
| SMILES | Cc1cc(C)c(C2C(=O)C3CCC4(CC3C2=O)OCCO4)c(Br)c1 |
| InChI | InChI=1S/C19H21BrO4/c1-10-7-11(2)15(14(20)8-10)16-17(21)12-3-4-19(23-5-6-24-19)9-13(12)18(16)22/h7-8,12-13,16H,3-6,9H2,1-2H3 |
| InChIKey | CVIBMFOMPKIOLI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|