About (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate
(2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate (PubChem CID 91412906) has the molecular formula C14H12F3NO5
and a molecular weight of 331.25 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate |
| PubChem CID | 91412906 |
| Molecular Formula | C14H12F3NO5 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate |
| SMILES | CC(OC(=O)On1c(O)ccc1O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F3NO5/c1-8(9-2-4-10(5-3-9)14(15,16)17)22-13(21)23-18-11(19)6-7-12(18)20/h2-8,19-20H,1H3 |
| InChIKey | KFIZRSCOTYWCFE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate (CID 91412906) is (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate is CC(OC(=O)On1c(O)ccc1O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate?
The InChIKey is KFIZRSCOTYWCFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3NO5/c1-8(9-2-4-10(5-3-9)14(15,16)17)22-13(21)23-18-11(19)6-7-12(18)20/h2-8,19-20H,1H3.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate?
(2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate has a molecular weight of 331.25 g/mol, XLogP of 3.24, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 1-[4-(trifluoromethyl)phenyl]ethyl carbonate is sourced from PubChem (CID 91412906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).