C17H22I2O9 — CID 91413044
[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diiodoprop-1-enyl)oxan-2-yl]methyl acetate (PubChem CID 91413044) has the molecular formula C17H22I2O9 and a molecular weight of 624.16 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diiodoprop-1-enyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diiodoprop-1-enyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91413044 |
| Molecular Formula | C17H22I2O9 |
| Molecular Weight | 624.16 g/mol |
| Exact Mass | 623.94 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(2,3-diiodoprop-1-enyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C=C(I)CI)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H22I2O9/c1-8(20)24-7-14-16(26-10(3)22)17(27-11(4)23)15(25-9(2)21)13(28-14)5-12(19)6-18/h5,13-17H,6-7H2,1-4H3/t13-,14+,15-,16-,17+/m0/s1 |
| InChIKey | HDOHZUCDORRBLU-BQJWPVKWSA-N |
| XLogP | 1.87 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.16 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|