C2H6N4S — CID 91413053
5-amino-2,3-dihydro-1H-1,2,4-triazole-3-thiol (PubChem CID 91413053) has the molecular formula C2H6N4S and a molecular weight of 118.17 g/mol. Its IUPAC name is 5-amino-2,3-dihydro-1H-1,2,4-triazole-3-thiol.
| Compound Name | 5-amino-2,3-dihydro-1H-1,2,4-triazole-3-thiol |
|---|---|
| PubChem CID | 91413053 |
| Molecular Formula | C2H6N4S |
| Molecular Weight | 118.17 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | 5-amino-2,3-dihydro-1H-1,2,4-triazole-3-thiol |
| SMILES | NC1=NC(S)NN1 |
| InChI | InChI=1S/C2H6N4S/c3-1-4-2(7)6-5-1/h2,6-7H,(H3,3,4,5) |
| InChIKey | MPHZFTOIHPMKAI-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.17 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|