C9H11N — CID 91413289
3-ethyl-4,5-dimethylidenepyridine (PubChem CID 91413289) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 3-ethyl-4,5-dimethylidenepyridine.
| Compound Name | 3-ethyl-4,5-dimethylidenepyridine |
|---|---|
| PubChem CID | 91413289 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 3-ethyl-4,5-dimethylidenepyridine |
| SMILES | C=c1cncc(CC)c1=C |
| InChI | InChI=1S/C9H11N/c1-4-9-6-10-5-7(2)8(9)3/h5-6H,2-4H2,1H3 |
| InChIKey | FQKZXEDLHMVSTG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |