C18H25F6N3O3 — CID 91413361
N-(4-methylhepta-4,6-dien-2-yl)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 91413361) has the molecular formula C18H25F6N3O3 and a molecular weight of 445.40 g/mol. Its IUPAC name is N-(4-methylhepta-4,6-dien-2-yl)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | N-(4-methylhepta-4,6-dien-2-yl)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 91413361 |
| Molecular Formula | C18H25F6N3O3 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-(4-methylhepta-4,6-dien-2-yl)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | C=CC=C(C)CC(C)NC(=O)C(CCCCNC(=O)C(F)(F)F)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H25F6N3O3/c1-4-7-11(2)10-12(3)26-14(28)13(27-16(30)18(22,23)24)8-5-6-9-25-15(29)17(19,20)21/h4,7,12-13H,1,5-6,8-10H2,2-3H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | DOFUWXKVZVYVLT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|