C32H52O5Si — CID 91413841
[(1R,2S,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-(6-methylhept-2-en-2-yl)cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 91413841) has the molecular formula C32H52O5Si and a molecular weight of 544.85 g/mol. Its IUPAC name is [(1R,2S,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-(6-methylhept-2-en-2-yl)cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2S,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-(6-methylhept-2-en-2-yl)cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91413841 |
| Molecular Formula | C32H52O5Si |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | [(1R,2S,3S,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxy-3-(6-methylhept-2-en-2-yl)cyclohexyl] 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OC2CC[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C(C)=CCCC(C)C)[C@@H]2OC)cc1 |
| InChI | InChI=1S/C32H52O5Si/c1-23(2)12-11-13-24(3)30-26(22-36-38(9,10)32(4,5)6)17-20-28(31(30)35-8)37-29(33)21-16-25-14-18-27(34-7)19-15-25/h13-16,18-19,21,23,26,28,30-31H,11-12,17,20,22H2,1-10H3/t26-,28?,30-,31-/m1/s1 |
| InChIKey | HKEQVIZHEPOIHJ-KCFDROKRSA-N |
| XLogP | 8.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|