C17H19F6N5O — CID 91414267
3-imino-1-[3-methyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 91414267) has the molecular formula C17H19F6N5O and a molecular weight of 423.36 g/mol. Its IUPAC name is 3-imino-1-[3-methyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-imino-1-[3-methyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 91414267 |
| Molecular Formula | C17H19F6N5O |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-imino-1-[3-methyl-4-(2,2,2-trifluoroethanehydrazonoyl)piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | [H]/N=C(\CC(=O)N1CCN(C(=NN)C(F)(F)F)C(C)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H19F6N5O/c1-9-8-27(2-3-28(9)16(26-25)17(21,22)23)15(29)6-11(24)4-10-5-13(19)14(20)7-12(10)18/h5,7,9,24H,2-4,6,8,25H2,1H3/b24-11-,26-16? |
| InChIKey | UHBXXORSKYPLGP-KUMFXPLVSA-N |
| XLogP | 2.42 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|