C22H25Cl2N3O — CID 91414318
(3S,5R)-N-(2-amino-4,5-dichlorophenyl)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 91414318) has the molecular formula C22H25Cl2N3O and a molecular weight of 418.37 g/mol. Its IUPAC name is (3S,5R)-N-(2-amino-4,5-dichlorophenyl)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (3S,5R)-N-(2-amino-4,5-dichlorophenyl)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 91414318 |
| Molecular Formula | C22H25Cl2N3O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (3S,5R)-N-(2-amino-4,5-dichlorophenyl)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | Cc1ccc([C@H]2C[C@H]3CCC(C2C(=O)Nc2cc(Cl)c(Cl)cc2N)N3C)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O/c1-12-3-5-13(6-4-12)15-9-14-7-8-20(27(14)2)21(15)22(28)26-19-11-17(24)16(23)10-18(19)25/h3-6,10-11,14-15,20-21H,7-9,25H2,1-2H3,(H,26,28)/t14-,15-,20?,21?/m1/s1 |
| InChIKey | CJYCYEMWXZBOPY-VKFLQFAXSA-N |
| XLogP | 5.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|