C24H23F6N5O4 — CID 91414502
4-[6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]-3-nitro-1H-1,2,4-triazol-5-one (PubChem CID 91414502) has the molecular formula C24H23F6N5O4 and a molecular weight of 559.47 g/mol. Its IUPAC name is 4-[6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]-3-nitro-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]-3-nitro-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 91414502 |
| Molecular Formula | C24H23F6N5O4 |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | 4-[6-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-6-phenylpiperidin-3-yl]-3-nitro-1H-1,2,4-triazol-5-one |
| SMILES | C[C@@H](OCC1(c2ccccc2)CCC(n2c([N+](=O)[O-])n[nH]c2=O)CN1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H23F6N5O4/c1-14(15-9-17(23(25,26)27)11-18(10-15)24(28,29)30)39-13-22(16-5-3-2-4-6-16)8-7-19(12-31-22)34-20(35(37)38)32-33-21(34)36/h2-6,9-11,14,19,31H,7-8,12-13H2,1H3,(H,33,36)/t14-,19?,22?/m1/s1 |
| InChIKey | AFJYKATULICEAW-QDAZHVTCSA-N |
| XLogP | 5.11 |
| TPSA | 115.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|