About ethane;3H-imidazo[1,2-a]pyridin-2-one
ethane;3H-imidazo[1,2-a]pyridin-2-one (PubChem CID 91414792) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is ethane;3H-imidazo[1,2-a]pyridin-2-one.
Molecular Properties
| Compound Name | ethane;3H-imidazo[1,2-a]pyridin-2-one |
| PubChem CID | 91414792 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | ethane;3H-imidazo[1,2-a]pyridin-2-one |
| SMILES | CC.O=C1CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C7H6N2O.C2H6/c10-7-5-9-4-2-1-3-6(9)8-7;1-2/h1-4H,5H2;1-2H3 |
| InChIKey | PAYJBSYOPIILPW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3H-imidazo[1,2-a]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3H-imidazo[1,2-a]pyridin-2-one?
The IUPAC name of ethane;3H-imidazo[1,2-a]pyridin-2-one (CID 91414792) is ethane;3H-imidazo[1,2-a]pyridin-2-one.
What is the SMILES notation for ethane;3H-imidazo[1,2-a]pyridin-2-one?
The canonical SMILES for ethane;3H-imidazo[1,2-a]pyridin-2-one is CC.O=C1CN2C=CC=CC2=N1.
What is the InChIKey of ethane;3H-imidazo[1,2-a]pyridin-2-one?
The InChIKey is PAYJBSYOPIILPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O.C2H6/c10-7-5-9-4-2-1-3-6(9)8-7;1-2/h1-4H,5H2;1-2H3.
What are the key properties of ethane;3H-imidazo[1,2-a]pyridin-2-one?
ethane;3H-imidazo[1,2-a]pyridin-2-one has a molecular weight of 164.21 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3H-imidazo[1,2-a]pyridin-2-one is sourced from PubChem (CID 91414792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).