C13H15F3N5O4+ — CID 91414921
[6-amino-2-(2-cyclopropylethoxy)-8-methoxy-7H-purin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 91414921) has the molecular formula C13H15F3N5O4+ and a molecular weight of 362.29 g/mol. Its IUPAC name is [6-amino-2-(2-cyclopropylethoxy)-8-methoxy-7H-purin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [6-amino-2-(2-cyclopropylethoxy)-8-methoxy-7H-purin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91414921 |
| Molecular Formula | C13H15F3N5O4+ |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [6-amino-2-(2-cyclopropylethoxy)-8-methoxy-7H-purin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1nc2nc(OCCC3CC3)[n+](OC(=O)C(F)(F)F)c(N)c2[nH]1 |
| InChI | InChI=1S/C13H14F3N5O4/c1-23-11-18-7-8(17)21(25-10(22)13(14,15)16)12(20-9(7)19-11)24-5-4-6-2-3-6/h6H,2-5H2,1H3,(H2,17,18,19)/p+1 |
| InChIKey | HVZSHWBOJYALFV-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|