C9H21N+2 — CID 91415048
2,2-dimethylbutyl(trimethyl)azanium (PubChem CID 91415048) has the molecular formula C9H21N+2 and a molecular weight of 143.27 g/mol. Its IUPAC name is 2,2-dimethylbutyl(trimethyl)azanium.
| Compound Name | 2,2-dimethylbutyl(trimethyl)azanium |
|---|---|
| PubChem CID | 91415048 |
| Molecular Formula | C9H21N+2 |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | 2,2-dimethylbutyl(trimethyl)azanium |
| SMILES | C[CH+]C(C)(C)C[N+](C)(C)C |
| InChI | InChI=1S/C9H21N/c1-7-9(2,3)8-10(4,5)6/h7H,8H2,1-6H3/q+2 |
| InChIKey | VDEUUVMBOYQBCE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|