About 6-chloro-2,5-dimethylhexa-1,4-diene
6-chloro-2,5-dimethylhexa-1,4-diene (PubChem CID 91415088) has the molecular formula C8H13Cl
and a molecular weight of 144.64 g/mol. Its IUPAC name is 6-chloro-2,5-dimethylhexa-1,4-diene.
Molecular Properties
| Compound Name | 6-chloro-2,5-dimethylhexa-1,4-diene |
| PubChem CID | 91415088 |
| Molecular Formula | C8H13Cl |
| Molecular Weight | 144.64 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 6-chloro-2,5-dimethylhexa-1,4-diene |
| SMILES | C=C(C)CC=C(C)CCl |
| InChI | InChI=1S/C8H13Cl/c1-7(2)4-5-8(3)6-9/h5H,1,4,6H2,2-3H3 |
| InChIKey | TYFJTHRBWBYMQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,5-dimethylhexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,5-dimethylhexa-1,4-diene?
The IUPAC name of 6-chloro-2,5-dimethylhexa-1,4-diene (CID 91415088) is 6-chloro-2,5-dimethylhexa-1,4-diene.
What is the SMILES notation for 6-chloro-2,5-dimethylhexa-1,4-diene?
The canonical SMILES for 6-chloro-2,5-dimethylhexa-1,4-diene is C=C(C)CC=C(C)CCl.
What is the InChIKey of 6-chloro-2,5-dimethylhexa-1,4-diene?
The InChIKey is TYFJTHRBWBYMQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Cl/c1-7(2)4-5-8(3)6-9/h5H,1,4,6H2,2-3H3.
What are the key properties of 6-chloro-2,5-dimethylhexa-1,4-diene?
6-chloro-2,5-dimethylhexa-1,4-diene has a molecular weight of 144.64 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,5-dimethylhexa-1,4-diene is sourced from PubChem (CID 91415088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).