C16H26N2 — CID 91415324
1,2,2-trimethyl-3-(2,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)imidazolidine (PubChem CID 91415324) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1,2,2-trimethyl-3-(2,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)imidazolidine.
| Compound Name | 1,2,2-trimethyl-3-(2,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)imidazolidine |
|---|---|
| PubChem CID | 91415324 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1,2,2-trimethyl-3-(2,3,5-trimethylcyclohepta-1,4,6-trien-1-yl)imidazolidine |
| SMILES | CC1=CC(C)C(C)=C(N2CCN(C)C2(C)C)C=C1 |
| InChI | InChI=1S/C16H26N2/c1-12-7-8-15(14(3)13(2)11-12)18-10-9-17(6)16(18,4)5/h7-8,11,13H,9-10H2,1-6H3 |
| InChIKey | IQBLLGKAEFFKAZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |