C18H20O3 — CID 91416064
1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene (PubChem CID 91416064) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 91416064 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene |
| SMILES | COc1cc(C2CCc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C18H20O3/c1-19-16-10-13(11-17(20-2)18(16)21-3)15-9-8-12-6-4-5-7-14(12)15/h4-7,10-11,15H,8-9H2,1-3H3 |
| InChIKey | JQZKBYXCAKQMOW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |