C18H35N3O — CID 91416111
N-[1-imino-4-methyl-1-(methylideneamino)pentan-2-yl]-7,8-dimethylnonanamide (PubChem CID 91416111) has the molecular formula C18H35N3O and a molecular weight of 309.50 g/mol. Its IUPAC name is N-[1-imino-4-methyl-1-(methylideneamino)pentan-2-yl]-7,8-dimethylnonanamide.
| Compound Name | N-[1-imino-4-methyl-1-(methylideneamino)pentan-2-yl]-7,8-dimethylnonanamide |
|---|---|
| PubChem CID | 91416111 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | N-[1-imino-4-methyl-1-(methylideneamino)pentan-2-yl]-7,8-dimethylnonanamide |
| SMILES | [H]/N=C(\N=C)C(CC(C)C)NC(=O)CCCCCC(C)C(C)C |
| InChI | InChI=1S/C18H35N3O/c1-13(2)12-16(18(19)20-6)21-17(22)11-9-7-8-10-15(5)14(3)4/h13-16,19H,6-12H2,1-5H3,(H,21,22)/b19-18- |
| InChIKey | JOKATZUPAGVYLS-HNENSFHCSA-N |
| XLogP | 4.44 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|