About 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid
4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid (PubChem CID 91416235) has the molecular formula C9H14ClNO4
and a molecular weight of 235.67 g/mol. Its IUPAC name is 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid |
| PubChem CID | 91416235 |
| Molecular Formula | C9H14ClNO4 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid |
| SMILES | O=C(O)N1CCC(CCCl)(C(=O)O)CC1 |
| InChI | InChI=1S/C9H14ClNO4/c10-4-1-9(7(12)13)2-5-11(6-3-9)8(14)15/h1-6H2,(H,12,13)(H,14,15) |
| InChIKey | YTEBVHMDANRYAX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid?
The IUPAC name of 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid (CID 91416235) is 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid.
What is the SMILES notation for 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid?
The canonical SMILES for 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid is O=C(O)N1CCC(CCCl)(C(=O)O)CC1.
What is the InChIKey of 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid?
The InChIKey is YTEBVHMDANRYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClNO4/c10-4-1-9(7(12)13)2-5-11(6-3-9)8(14)15/h1-6H2,(H,12,13)(H,14,15).
What are the key properties of 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid?
4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid has a molecular weight of 235.67 g/mol, XLogP of 1.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)piperidine-1,4-dicarboxylic acid is sourced from PubChem (CID 91416235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).