About 1,7a-dihydro-2,1-benzoxazole
1,7a-dihydro-2,1-benzoxazole (PubChem CID 91416375) has the molecular formula C7H7NO
and a molecular weight of 121.14 g/mol. Its IUPAC name is 1,7a-dihydro-2,1-benzoxazole.
Molecular Properties
| Compound Name | 1,7a-dihydro-2,1-benzoxazole |
| PubChem CID | 91416375 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 1,7a-dihydro-2,1-benzoxazole |
| SMILES | C1=CC2=CONC2C=C1 |
| InChI | InChI=1S/C7H7NO/c1-2-4-7-6(3-1)5-9-8-7/h1-5,7-8H |
| InChIKey | NDANNCHMBXREIK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7a-dihydro-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7a-dihydro-2,1-benzoxazole?
The IUPAC name of 1,7a-dihydro-2,1-benzoxazole (CID 91416375) is 1,7a-dihydro-2,1-benzoxazole.
What is the SMILES notation for 1,7a-dihydro-2,1-benzoxazole?
The canonical SMILES for 1,7a-dihydro-2,1-benzoxazole is C1=CC2=CONC2C=C1.
What is the InChIKey of 1,7a-dihydro-2,1-benzoxazole?
The InChIKey is NDANNCHMBXREIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO/c1-2-4-7-6(3-1)5-9-8-7/h1-5,7-8H.
What are the key properties of 1,7a-dihydro-2,1-benzoxazole?
1,7a-dihydro-2,1-benzoxazole has a molecular weight of 121.14 g/mol, XLogP of 0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7a-dihydro-2,1-benzoxazole is sourced from PubChem (CID 91416375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).