C36H40N4O6S — CID 91416389
methyl 5-[13-cyclohexyl-10-[(formyl-oxo-propan-2-ylidene-λ6-sulfanyl)carbamoyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl]-1,3-dimethylpyrazole-4-carboxylate (PubChem CID 91416389) has the molecular formula C36H40N4O6S and a molecular weight of 656.81 g/mol. Its IUPAC name is methyl 5-[13-cyclohexyl-10-[(formyl-oxo-propan-2-ylidene-λ6-sulfanyl)carbamoyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl]-1,3-dimethylpyrazole-4-carboxylate.
| Compound Name | methyl 5-[13-cyclohexyl-10-[(formyl-oxo-propan-2-ylidene-λ6-sulfanyl)carbamoyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl]-1,3-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 91416389 |
| Molecular Formula | C36H40N4O6S |
| Molecular Weight | 656.81 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | methyl 5-[13-cyclohexyl-10-[(formyl-oxo-propan-2-ylidene-λ6-sulfanyl)carbamoyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepin-6-yl]-1,3-dimethylpyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(C)nn(C)c1C1=Cc2cc(OC)ccc2-c2c(C3CCCCC3)c3ccc(C(=O)NS(=O)(C=O)=C(C)C)cc3n2C1 |
| InChI | InChI=1S/C36H40N4O6S/c1-21(2)47(44,20-41)38-35(42)24-12-14-29-30(18-24)40-19-26(33-31(36(43)46-6)22(3)37-39(33)4)16-25-17-27(45-5)13-15-28(25)34(40)32(29)23-10-8-7-9-11-23/h12-18,20,23H,7-11,19H2,1-6H3,(H,38,42,44) |
| InChIKey | CRQKVQGSMCUKRP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.81 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|