C31H30F2N4O3 — CID 91416714
2-[6-(3,5-difluorophenyl)-3,3-dimethyl-2-oxopiperidin-1-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)propanamide (PubChem CID 91416714) has the molecular formula C31H30F2N4O3 and a molecular weight of 544.60 g/mol. Its IUPAC name is 2-[6-(3,5-difluorophenyl)-3,3-dimethyl-2-oxopiperidin-1-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)propanamide.
| Compound Name | 2-[6-(3,5-difluorophenyl)-3,3-dimethyl-2-oxopiperidin-1-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)propanamide |
|---|---|
| PubChem CID | 91416714 |
| Molecular Formula | C31H30F2N4O3 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 2-[6-(3,5-difluorophenyl)-3,3-dimethyl-2-oxopiperidin-1-yl]-N-(2'-oxospiro[1,3-dihydroindene-2,3'-1H-pyrrolo[2,3-b]pyridine]-5-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc2c(c1)CC1(C2)C(=O)Nc2ncccc21)N1C(=O)C(C)(C)CCC1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C31H30F2N4O3/c1-17(37-25(8-9-30(2,3)29(37)40)19-11-21(32)14-22(33)12-19)27(38)35-23-7-6-18-15-31(16-20(18)13-23)24-5-4-10-34-26(24)36-28(31)39/h4-7,10-14,17,25H,8-9,15-16H2,1-3H3,(H,35,38)(H,34,36,39) |
| InChIKey | XGBYMJICTUVUAM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |