C25H35BF2N3+ — CID 91416865
5-(3-butylphenyl)-7,8-diethyl-11,13-difluoro-7,8-dimethyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene (PubChem CID 91416865) has the molecular formula C25H35BF2N3+ and a molecular weight of 426.38 g/mol. Its IUPAC name is 5-(3-butylphenyl)-7,8-diethyl-11,13-difluoro-7,8-dimethyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene.
| Compound Name | 5-(3-butylphenyl)-7,8-diethyl-11,13-difluoro-7,8-dimethyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 91416865 |
| Molecular Formula | C25H35BF2N3+ |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 5-(3-butylphenyl)-7,8-diethyl-11,13-difluoro-7,8-dimethyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(13),9,11-triene |
| SMILES | CCCCc1cccc(N2CCN3B2C(C)(CC)C(C)(CC)[n+]2cc(F)cc(F)c23)c1 |
| InChI | InChI=1S/C25H35BF2N3/c1-6-9-11-19-12-10-13-21(16-19)30-14-15-31-23-22(28)17-20(27)18-29(23)25(5,8-3)24(4,7-2)26(30)31/h10,12-13,16-18H,6-9,11,14-15H2,1-5H3/q+1 |
| InChIKey | WORBWIIDXHBDLS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|