About 2-hex-1-en-2-ylfuran
2-hex-1-en-2-ylfuran (PubChem CID 91416997) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-hex-1-en-2-ylfuran.
Molecular Properties
| Compound Name | 2-hex-1-en-2-ylfuran |
| PubChem CID | 91416997 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-hex-1-en-2-ylfuran |
| SMILES | C=C(CCCC)c1ccco1 |
| InChI | InChI=1S/C10H14O/c1-3-4-6-9(2)10-7-5-8-11-10/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | RXKMZCNJOCHRIJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-hex-1-en-2-ylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-1-en-2-ylfuran?
The IUPAC name of 2-hex-1-en-2-ylfuran (CID 91416997) is 2-hex-1-en-2-ylfuran.
What is the SMILES notation for 2-hex-1-en-2-ylfuran?
The canonical SMILES for 2-hex-1-en-2-ylfuran is C=C(CCCC)c1ccco1.
What is the InChIKey of 2-hex-1-en-2-ylfuran?
The InChIKey is RXKMZCNJOCHRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-3-4-6-9(2)10-7-5-8-11-10/h5,7-8H,2-4,6H2,1H3.
What are the key properties of 2-hex-1-en-2-ylfuran?
2-hex-1-en-2-ylfuran has a molecular weight of 150.22 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-1-en-2-ylfuran is sourced from PubChem (CID 91416997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).