About 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one
3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one (PubChem CID 91417232) has the molecular formula C16H12Cl2N2O3
and a molecular weight of 351.19 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one |
| PubChem CID | 91417232 |
| Molecular Formula | C16H12Cl2N2O3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one |
| SMILES | O=c1[nH]c(Cc2cccc(O)c2)c(O)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O3/c17-10-6-11(18)8-12(7-10)20-15(22)14(19-16(20)23)5-9-2-1-3-13(21)4-9/h1-4,6-8,21-22H,5H2,(H,19,23) |
| InChIKey | OTRBCCMHTBFCPS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one?
The IUPAC name of 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one (CID 91417232) is 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one.
What is the SMILES notation for 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one?
The canonical SMILES for 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one is O=c1[nH]c(Cc2cccc(O)c2)c(O)n1-c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one?
The InChIKey is OTRBCCMHTBFCPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl2N2O3/c17-10-6-11(18)8-12(7-10)20-15(22)14(19-16(20)23)5-9-2-1-3-13(21)4-9/h1-4,6-8,21-22H,5H2,(H,19,23).
What are the key properties of 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one?
3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one has a molecular weight of 351.19 g/mol, XLogP of 3.47, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichlorophenyl)-4-hydroxy-5-[(3-hydroxyphenyl)methyl]-1H-imidazol-2-one is sourced from PubChem (CID 91417232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).