C17H17BrClNO4 — CID 91417583
(1R,2S,4R,5S,8S,12R)-7-(3-bromo-4-chlorophenyl)-2-hydroxy-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one (PubChem CID 91417583) has the molecular formula C17H17BrClNO4 and a molecular weight of 414.68 g/mol. Its IUPAC name is (1R,2S,4R,5S,8S,12R)-7-(3-bromo-4-chlorophenyl)-2-hydroxy-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one.
| Compound Name | (1R,2S,4R,5S,8S,12R)-7-(3-bromo-4-chlorophenyl)-2-hydroxy-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
|---|---|
| PubChem CID | 91417583 |
| Molecular Formula | C17H17BrClNO4 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | (1R,2S,4R,5S,8S,12R)-7-(3-bromo-4-chlorophenyl)-2-hydroxy-4-methyl-9,13-dioxa-7-azatetracyclo[6.3.1.11,4.05,12]tridecan-6-one |
| SMILES | C[C@@]12C[C@H](O)[C@]3(CCO[C@H]4[C@@H]3[C@@H]1C(=O)N4c1ccc(Cl)c(Br)c1)O2 |
| InChI | InChI=1S/C17H17BrClNO4/c1-16-7-11(21)17(24-16)4-5-23-15-13(17)12(16)14(22)20(15)8-2-3-10(19)9(18)6-8/h2-3,6,11-13,15,21H,4-5,7H2,1H3/t11-,12+,13-,15-,16+,17-/m0/s1 |
| InChIKey | LTSDNSJIOGQJNF-YMWMKHGGSA-N |
| XLogP | 2.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |