C25H20F6N6O3S — CID 91418279
[3-(4-methylimidazol-1-yl)-6-[2-[8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 91418279) has the molecular formula C25H20F6N6O3S and a molecular weight of 598.53 g/mol. Its IUPAC name is [3-(4-methylimidazol-1-yl)-6-[2-[8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [3-(4-methylimidazol-1-yl)-6-[2-[8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91418279 |
| Molecular Formula | C25H20F6N6O3S |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | [3-(4-methylimidazol-1-yl)-6-[2-[8-[2-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl]ethenyl]-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1cn(-c2ccc(C=Cc3nc4n(n3)CCCC4c3ccccc3C(F)(F)F)nc2OS(=O)(=O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C25H20F6N6O3S/c1-15-13-36(14-32-15)20-10-8-16(33-23(20)40-41(38,39)25(29,30)31)9-11-21-34-22-18(6-4-12-37(22)35-21)17-5-2-3-7-19(17)24(26,27)28/h2-3,5,7-11,13-14,18H,4,6,12H2,1H3 |
| InChIKey | RDWPJAGQNVUCQB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 104.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|