C27H32O2 — CID 91418366
(8S,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one (PubChem CID 91418366) has the molecular formula C27H32O2 and a molecular weight of 388.55 g/mol. Its IUPAC name is (8S,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (8S,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 91418366 |
| Molecular Formula | C27H32O2 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (8S,9S,13S,14S)-2-ethyl-13-methyl-3-phenylmethoxy-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-6-one |
| SMILES | CCc1cc2c(cc1OCc1ccccc1)C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)CCC[C@@H]12 |
| InChI | InChI=1S/C27H32O2/c1-3-19-14-21-20-11-13-27(2)12-7-10-24(27)22(20)15-25(28)23(21)16-26(19)29-17-18-8-5-4-6-9-18/h4-6,8-9,14,16,20,22,24H,3,7,10-13,15,17H2,1-2H3/t20-,22-,24+,27+/m1/s1 |
| InChIKey | YRFNLFMLZGGUBX-YDGNWZKSSA-N |
| XLogP | 6.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |