About 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde
2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde (PubChem CID 91418594) has the molecular formula C9H16N2O3
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde |
| PubChem CID | 91418594 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde |
| SMILES | O=CN1CCNCC1CC1OCCO1 |
| InChI | InChI=1S/C9H16N2O3/c12-7-11-2-1-10-6-8(11)5-9-13-3-4-14-9/h7-10H,1-6H2 |
| InChIKey | PKZGZIVAEYFBLU-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde?
The IUPAC name of 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde (CID 91418594) is 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde.
What is the SMILES notation for 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde?
The canonical SMILES for 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde is O=CN1CCNCC1CC1OCCO1.
What is the InChIKey of 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde?
The InChIKey is PKZGZIVAEYFBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c12-7-11-2-1-10-6-8(11)5-9-13-3-4-14-9/h7-10H,1-6H2.
What are the key properties of 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde?
2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde has a molecular weight of 200.24 g/mol, XLogP of -0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-ylmethyl)piperazine-1-carbaldehyde is sourced from PubChem (CID 91418594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).