C11H22N2 — CID 91418894
1,6-dimethyl-2-methylidenepyrimidine;ethane (PubChem CID 91418894) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1,6-dimethyl-2-methylidenepyrimidine;ethane.
| Compound Name | 1,6-dimethyl-2-methylidenepyrimidine;ethane |
|---|---|
| PubChem CID | 91418894 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1,6-dimethyl-2-methylidenepyrimidine;ethane |
| SMILES | C=C1N=CC=C(C)N1C.CC.CC |
| InChI | InChI=1S/C7H10N2.2C2H6/c1-6-4-5-8-7(2)9(6)3;2*1-2/h4-5H,2H2,1,3H3;2*1-2H3 |
| InChIKey | ICORBQZGTPNJKZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |