C31H37F3N4O5 — CID 91418970
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-2-propoxy-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione (PubChem CID 91418970) has the molecular formula C31H37F3N4O5 and a molecular weight of 602.65 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-2-propoxy-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-2-propoxy-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91418970 |
| Molecular Formula | C31H37F3N4O5 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-[4-hydroxy-2-propoxy-5-(2,2,2-trifluoroethyl)phenyl]ethyl]oxane-2,4-dione |
| SMILES | CCCOc1cc(O)c(CC(F)(F)F)cc1CCC1(C2CCCC2)CC(=O)C(Cc2nc3nc(C)cc(C)n3n2)C(=O)O1 |
| InChI | InChI=1S/C31H37F3N4O5/c1-4-11-42-26-15-24(39)21(16-31(32,33)34)13-20(26)9-10-30(22-7-5-6-8-22)17-25(40)23(28(41)43-30)14-27-36-29-35-18(2)12-19(3)38(29)37-27/h12-13,15,22-23,39H,4-11,14,16-17H2,1-3H3 |
| InChIKey | XVVAUHWYFUSLJA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 115.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|