C22H21F4N7O2 — CID 91419166
6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxy-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine (PubChem CID 91419166) has the molecular formula C22H21F4N7O2 and a molecular weight of 491.45 g/mol. Its IUPAC name is 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxy-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine.
| Compound Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxy-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 91419166 |
| Molecular Formula | C22H21F4N7O2 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 6-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-2-methoxy-N-[3-(trifluoromethyl)phenyl]pyridin-3-amine |
| SMILES | COc1nc(C/N=N/c2ncc(F)c(N3CCOCC3)n2)ccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H21F4N7O2/c1-34-20-18(29-15-4-2-3-14(11-15)22(24,25)26)6-5-16(30-20)12-28-32-21-27-13-17(23)19(31-21)33-7-9-35-10-8-33/h2-6,11,13,29H,7-10,12H2,1H3/b32-28+ |
| InChIKey | SLIDFYGDPRGRKG-VEWQFJOQSA-N |
| XLogP | 4.90 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|