About ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate
ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate (PubChem CID 91419376) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate |
| PubChem CID | 91419376 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate |
| SMILES | [H]/N=C1\CCC(C)(C)C1C(=O)OCC |
| InChI | InChI=1S/C10H17NO2/c1-4-13-9(12)8-7(11)5-6-10(8,2)3/h8,11H,4-6H2,1-3H3/b11-7+ |
| InChIKey | AAYDTCLXORWUTE-YRNVUSSQSA-N |
| XLogP | 2.01 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate?
The IUPAC name of ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate (CID 91419376) is ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate.
What is the SMILES notation for ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate?
The canonical SMILES for ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate is [H]/N=C1\CCC(C)(C)C1C(=O)OCC.
What is the InChIKey of ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate?
The InChIKey is AAYDTCLXORWUTE-YRNVUSSQSA-N. The full InChI is InChI=1S/C10H17NO2/c1-4-13-9(12)8-7(11)5-6-10(8,2)3/h8,11H,4-6H2,1-3H3/b11-7+.
What are the key properties of ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate?
ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate has a molecular weight of 183.25 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-imino-2,2-dimethylcyclopentane-1-carboxylate is sourced from PubChem (CID 91419376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).