C20H34O5 — CID 91419688
(1S,5S,8S,9R,12R,15R)-4,8,15,16,16-pentamethyl-11-oxatricyclo[10.3.1.05,15]hexadec-3-ene-9,13,14,14-tetrol (PubChem CID 91419688) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (1S,5S,8S,9R,12R,15R)-4,8,15,16,16-pentamethyl-11-oxatricyclo[10.3.1.05,15]hexadec-3-ene-9,13,14,14-tetrol.
| Compound Name | (1S,5S,8S,9R,12R,15R)-4,8,15,16,16-pentamethyl-11-oxatricyclo[10.3.1.05,15]hexadec-3-ene-9,13,14,14-tetrol |
|---|---|
| PubChem CID | 91419688 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (1S,5S,8S,9R,12R,15R)-4,8,15,16,16-pentamethyl-11-oxatricyclo[10.3.1.05,15]hexadec-3-ene-9,13,14,14-tetrol |
| SMILES | CC1=CC[C@H]2C(C)(C)[C@H]3OC[C@H](O)[C@@H](C)CC[C@@H]1[C@@]2(C)C(O)(O)C3O |
| InChI | InChI=1S/C20H34O5/c1-11-7-9-15-18(3,4)17-16(22)20(23,24)19(15,5)13(11)8-6-12(2)14(21)10-25-17/h7,12-17,21-24H,6,8-10H2,1-5H3/t12-,13-,14-,15-,16?,17-,19+/m0/s1 |
| InChIKey | JVDDEJYSOQIYBT-DEXMDNOISA-N |
| XLogP | 1.83 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|