C27H26F3NO4 — CID 91420275
2-[2-methyl-3-[2-[[4,4,4-trifluoro-1-(4-phenylphenyl)but-1-enyl]amino]oxyethoxy]phenyl]acetic acid (PubChem CID 91420275) has the molecular formula C27H26F3NO4 and a molecular weight of 485.50 g/mol. Its IUPAC name is 2-[2-methyl-3-[2-[[4,4,4-trifluoro-1-(4-phenylphenyl)but-1-enyl]amino]oxyethoxy]phenyl]acetic acid.
| Compound Name | 2-[2-methyl-3-[2-[[4,4,4-trifluoro-1-(4-phenylphenyl)but-1-enyl]amino]oxyethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 91420275 |
| Molecular Formula | C27H26F3NO4 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-[2-methyl-3-[2-[[4,4,4-trifluoro-1-(4-phenylphenyl)but-1-enyl]amino]oxyethoxy]phenyl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cccc1OCCONC(=CCC(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26F3NO4/c1-19-23(18-26(32)33)8-5-9-25(19)34-16-17-35-31-24(14-15-27(28,29)30)22-12-10-21(11-13-22)20-6-3-2-4-7-20/h2-14,31H,15-18H2,1H3,(H,32,33) |
| InChIKey | GYJZKKQBSGDNJG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|