C11H22F3NO2S — CID 91420589
2,2,4,4-tetramethyl-N-(trifluoromethyl)hexane-1-sulfonamide (PubChem CID 91420589) has the molecular formula C11H22F3NO2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-N-(trifluoromethyl)hexane-1-sulfonamide.
| Compound Name | 2,2,4,4-tetramethyl-N-(trifluoromethyl)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 91420589 |
| Molecular Formula | C11H22F3NO2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2,2,4,4-tetramethyl-N-(trifluoromethyl)hexane-1-sulfonamide |
| SMILES | CCC(C)(C)CC(C)(C)CS(=O)(=O)NC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO2S/c1-6-9(2,3)7-10(4,5)8-18(16,17)15-11(12,13)14/h15H,6-8H2,1-5H3 |
| InChIKey | OSONSDHUFQYQAZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|