C22H42N6 — CID 91420939
3-[8-(2-cyanoethyl)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile (PubChem CID 91420939) has the molecular formula C22H42N6 and a molecular weight of 390.62 g/mol. Its IUPAC name is 3-[8-(2-cyanoethyl)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile.
| Compound Name | 3-[8-(2-cyanoethyl)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile |
|---|---|
| PubChem CID | 91420939 |
| Molecular Formula | C22H42N6 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.35 |
| IUPAC Name | 3-[8-(2-cyanoethyl)-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradec-1-yl]propanenitrile |
| SMILES | CC1CC(C)(C)NCCN(CCC#N)C(C)CC(C)(C)NCCN1CCC#N |
| InChI | InChI=1S/C22H42N6/c1-19-17-21(3,4)25-12-16-28(14-8-10-24)20(2)18-22(5,6)26-11-15-27(19)13-7-9-23/h19-20,25-26H,7-8,11-18H2,1-6H3 |
| InChIKey | TWTBZJJWNOYAHD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |