About S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate
S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate (PubChem CID 91421783) has the molecular formula C12H11N3OS
and a molecular weight of 245.31 g/mol. Its IUPAC name is S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate.
Molecular Properties
| Compound Name | S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate |
| PubChem CID | 91421783 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate |
| SMILES | CC(C)n1c(SC(=O)C#N)nc2ccccc21 |
| InChI | InChI=1S/C12H11N3OS/c1-8(2)15-10-6-4-3-5-9(10)14-12(15)17-11(16)7-13/h3-6,8H,1-2H3 |
| InChIKey | KAMAHHHTDAVEMB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate?
The IUPAC name of S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate (CID 91421783) is S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate.
What is the SMILES notation for S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate?
The canonical SMILES for S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate is CC(C)n1c(SC(=O)C#N)nc2ccccc21.
What is the InChIKey of S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate?
The InChIKey is KAMAHHHTDAVEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3OS/c1-8(2)15-10-6-4-3-5-9(10)14-12(15)17-11(16)7-13/h3-6,8H,1-2H3.
What are the key properties of S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate?
S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate has a molecular weight of 245.31 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1-propan-2-ylbenzimidazol-2-yl) cyanomethanethioate is sourced from PubChem (CID 91421783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).