About 2-piperazin-1-yl-1,2-dihydroquinoxaline
2-piperazin-1-yl-1,2-dihydroquinoxaline (PubChem CID 91422374) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-piperazin-1-yl-1,2-dihydroquinoxaline.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-1,2-dihydroquinoxaline |
| PubChem CID | 91422374 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-piperazin-1-yl-1,2-dihydroquinoxaline |
| SMILES | C1=Nc2ccccc2NC1N1CCNCC1 |
| InChI | InChI=1S/C12H16N4/c1-2-4-11-10(3-1)14-9-12(15-11)16-7-5-13-6-8-16/h1-4,9,12-13,15H,5-8H2 |
| InChIKey | KPGVGIQLQUGHIY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-yl-1,2-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-1,2-dihydroquinoxaline?
The IUPAC name of 2-piperazin-1-yl-1,2-dihydroquinoxaline (CID 91422374) is 2-piperazin-1-yl-1,2-dihydroquinoxaline.
What is the SMILES notation for 2-piperazin-1-yl-1,2-dihydroquinoxaline?
The canonical SMILES for 2-piperazin-1-yl-1,2-dihydroquinoxaline is C1=Nc2ccccc2NC1N1CCNCC1.
What is the InChIKey of 2-piperazin-1-yl-1,2-dihydroquinoxaline?
The InChIKey is KPGVGIQLQUGHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-2-4-11-10(3-1)14-9-12(15-11)16-7-5-13-6-8-16/h1-4,9,12-13,15H,5-8H2.
What are the key properties of 2-piperazin-1-yl-1,2-dihydroquinoxaline?
2-piperazin-1-yl-1,2-dihydroquinoxaline has a molecular weight of 216.29 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-1,2-dihydroquinoxaline is sourced from PubChem (CID 91422374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).