About 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane
2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane (PubChem CID 91423085) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane.
Molecular Properties
| Compound Name | 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane |
| PubChem CID | 91423085 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane |
| SMILES | CC.c1cnc2c(c1)OCCO2 |
| InChI | InChI=1S/C7H7NO2.C2H6/c1-2-6-7(8-3-1)10-5-4-9-6;1-2/h1-3H,4-5H2;1-2H3 |
| InChIKey | BJYSQBACFDIVES-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane?
The IUPAC name of 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane (CID 91423085) is 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane.
What is the SMILES notation for 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane?
The canonical SMILES for 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane is CC.c1cnc2c(c1)OCCO2.
What is the InChIKey of 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane?
The InChIKey is BJYSQBACFDIVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H6/c1-2-6-7(8-3-1)10-5-4-9-6;1-2/h1-3H,4-5H2;1-2H3.
What are the key properties of 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane?
2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane has a molecular weight of 167.21 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine;ethane is sourced from PubChem (CID 91423085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).