C9H17N — CID 91423263
4-ethyl-5-propan-2-yl-3,4-dihydro-2H-pyrrole (PubChem CID 91423263) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is 4-ethyl-5-propan-2-yl-3,4-dihydro-2H-pyrrole.
| Compound Name | 4-ethyl-5-propan-2-yl-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 91423263 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 4-ethyl-5-propan-2-yl-3,4-dihydro-2H-pyrrole |
| SMILES | CCC1CCN=C1C(C)C |
| InChI | InChI=1S/C9H17N/c1-4-8-5-6-10-9(8)7(2)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | LSSKUXNZDCMHBB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |