C20H34 — CID 91423588
but-2-ene;ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 91423588) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is but-2-ene;ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | but-2-ene;ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 91423588 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | but-2-ene;ethane;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | C1C2CC3C4CC5CC(C14)C(C2)C3C5.CC.CC=CC |
| InChI | InChI=1S/C14H20.C4H8.C2H6/c1-7-2-12-10-4-8-5-11(9(1)10)13(3-7)14(12)6-8;1-3-4-2;1-2/h7-14H,1-6H2;3-4H,1-2H3;1-2H3 |
| InChIKey | BIHLPOQYLKXYGV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|