C22H35NO4S — CID 91424049
7-[3,5-dihydroxy-2-[3-hydroxy-5-(5-methylthiophen-2-yl)pentyl]cyclopentyl]hept-5-enamide (PubChem CID 91424049) has the molecular formula C22H35NO4S and a molecular weight of 409.59 g/mol. Its IUPAC name is 7-[3,5-dihydroxy-2-[3-hydroxy-5-(5-methylthiophen-2-yl)pentyl]cyclopentyl]hept-5-enamide.
| Compound Name | 7-[3,5-dihydroxy-2-[3-hydroxy-5-(5-methylthiophen-2-yl)pentyl]cyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 91424049 |
| Molecular Formula | C22H35NO4S |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 7-[3,5-dihydroxy-2-[3-hydroxy-5-(5-methylthiophen-2-yl)pentyl]cyclopentyl]hept-5-enamide |
| SMILES | Cc1ccc(CCC(O)CCC2C(O)CC(O)C2CC=CCCCC(N)=O)s1 |
| InChI | InChI=1S/C22H35NO4S/c1-15-8-11-17(28-15)12-9-16(24)10-13-19-18(20(25)14-21(19)26)6-4-2-3-5-7-22(23)27/h2,4,8,11,16,18-21,24-26H,3,5-7,9-10,12-14H2,1H3,(H2,23,27) |
| InChIKey | TUQCTMRBRRIGIV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|