About [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine
[3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine (PubChem CID 91424063) has the molecular formula C21H19F2N3O
and a molecular weight of 367.40 g/mol. Its IUPAC name is [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine.
Molecular Properties
| Compound Name | [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine |
| PubChem CID | 91424063 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine |
| SMILES | [H]/N=C(\c1cccnc1)c1nc(OCCc2ccccc2)ccc1C(C)(F)F |
| InChI | InChI=1S/C21H19F2N3O/c1-21(22,23)17-9-10-18(27-13-11-15-6-3-2-4-7-15)26-20(17)19(24)16-8-5-12-25-14-16/h2-10,12,14,24H,11,13H2,1H3/b24-19+ |
| InChIKey | IZOAKBJRMGXGTH-LYBHJNIJSA-N |
| XLogP | 4.63 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine?
The IUPAC name of [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine (CID 91424063) is [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine.
What is the SMILES notation for [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine?
The canonical SMILES for [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine is [H]/N=C(\c1cccnc1)c1nc(OCCc2ccccc2)ccc1C(C)(F)F.
What is the InChIKey of [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine?
The InChIKey is IZOAKBJRMGXGTH-LYBHJNIJSA-N. The full InChI is InChI=1S/C21H19F2N3O/c1-21(22,23)17-9-10-18(27-13-11-15-6-3-2-4-7-15)26-20(17)19(24)16-8-5-12-25-14-16/h2-10,12,14,24H,11,13H2,1H3/b24-19+.
What are the key properties of [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine?
[3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine has a molecular weight of 367.40 g/mol, XLogP of 4.63, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,1-difluoroethyl)-6-(2-phenylethoxy)-2-pyridinyl]-pyridin-3-ylmethanimine is sourced from PubChem (CID 91424063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).