C22H19FN6O2S — CID 91424075
2-cyano-N-[[2-[(3-fluorophenyl)methylcarbamoylamino]-1,3-thiazol-4-yl]methyl]-N-methyl-3-pyridin-3-ylprop-2-enamide (PubChem CID 91424075) has the molecular formula C22H19FN6O2S and a molecular weight of 450.50 g/mol. Its IUPAC name is 2-cyano-N-[[2-[(3-fluorophenyl)methylcarbamoylamino]-1,3-thiazol-4-yl]methyl]-N-methyl-3-pyridin-3-ylprop-2-enamide.
| Compound Name | 2-cyano-N-[[2-[(3-fluorophenyl)methylcarbamoylamino]-1,3-thiazol-4-yl]methyl]-N-methyl-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 91424075 |
| Molecular Formula | C22H19FN6O2S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-cyano-N-[[2-[(3-fluorophenyl)methylcarbamoylamino]-1,3-thiazol-4-yl]methyl]-N-methyl-3-pyridin-3-ylprop-2-enamide |
| SMILES | CN(Cc1csc(NC(=O)NCc2cccc(F)c2)n1)C(=O)C(C#N)=Cc1cccnc1 |
| InChI | InChI=1S/C22H19FN6O2S/c1-29(20(30)17(10-24)8-15-5-3-7-25-11-15)13-19-14-32-22(27-19)28-21(31)26-12-16-4-2-6-18(23)9-16/h2-9,11,14H,12-13H2,1H3,(H2,26,27,28,31) |
| InChIKey | MIBMDFBPGOQRNA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|