About CID 91424447
CID 91424447 (PubChem CID 91424447) has the molecular formula C17H18F2N2O2
and a molecular weight of 320.34 g/mol.
Molecular Properties
| Compound Name | CID 91424447 |
| PubChem CID | 91424447 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C1(NC(=O)NC1=O)C1(CCC(F)(F)CC1)C2 |
| InChI | InChI=1S/C17H18F2N2O2/c1-10-2-3-11-9-15(4-6-16(18,19)7-5-15)17(12(11)8-10)13(22)20-14(23)21-17/h2-3,8H,4-7,9H2,1H3,(H2,20,21,22,23) |
| InChIKey | KFLAHKMAVYZENR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze CID 91424447 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91424447?
The IUPAC name of CID 91424447 (CID 91424447) is not available.
What is the SMILES notation for CID 91424447?
The canonical SMILES for CID 91424447 is Cc1ccc2c(c1)C1(NC(=O)NC1=O)C1(CCC(F)(F)CC1)C2.
What is the InChIKey of CID 91424447?
The InChIKey is KFLAHKMAVYZENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F2N2O2/c1-10-2-3-11-9-15(4-6-16(18,19)7-5-15)17(12(11)8-10)13(22)20-14(23)21-17/h2-3,8H,4-7,9H2,1H3,(H2,20,21,22,23).
What are the key properties of CID 91424447?
CID 91424447 has a molecular weight of 320.34 g/mol, XLogP of 2.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91424447 is sourced from PubChem (CID 91424447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).