C24H43N4O7+ — CID 91424458
(2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3,3-diethoxypropylcarbamoyl)-2-methylpyrrolidin-1-ium-1-carboxamide (PubChem CID 91424458) has the molecular formula C24H43N4O7+ and a molecular weight of 499.63 g/mol. Its IUPAC name is (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3,3-diethoxypropylcarbamoyl)-2-methylpyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3,3-diethoxypropylcarbamoyl)-2-methylpyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91424458 |
| Molecular Formula | C24H43N4O7+ |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | (2R)-1-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3,3-diethoxypropylcarbamoyl)-2-methylpyrrolidin-1-ium-1-carboxamide |
| SMILES | CCOC(CCNC(=O)NC(=O)[N+]1(C(=O)[C@H](CC2CCCC2)CN(O)C=O)CCC[C@H]1C)OCC |
| InChI | InChI=1S/C24H42N4O7/c1-4-34-21(35-5-2)12-13-25-23(31)26-24(32)28(14-8-9-18(28)3)22(30)20(16-27(33)17-29)15-19-10-6-7-11-19/h17-21,33H,4-16H2,1-3H3,(H-,25,26,31,32)/p+1/t18-,20-,28?/m1/s1 |
| InChIKey | OEBZFHVMAVRPMD-UOEAOTCZSA-O |
| XLogP | 2.76 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|