C26H31NO7S — CID 91425084
3-[5-[(3R)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl]-1,3-dioxoisoindol-2-yl]propane-1-sulfonic acid (PubChem CID 91425084) has the molecular formula C26H31NO7S and a molecular weight of 501.60 g/mol. Its IUPAC name is 3-[5-[(3R)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl]-1,3-dioxoisoindol-2-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5-[(3R)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl]-1,3-dioxoisoindol-2-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91425084 |
| Molecular Formula | C26H31NO7S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 3-[5-[(3R)-3-[(4-methoxyphenyl)methoxy]-2,2-dimethylpent-4-enyl]-1,3-dioxoisoindol-2-yl]propane-1-sulfonic acid |
| SMILES | C=C[C@@H](OCc1ccc(OC)cc1)C(C)(C)Cc1ccc2c(c1)C(=O)N(CCCS(=O)(=O)O)C2=O |
| InChI | InChI=1S/C26H31NO7S/c1-5-23(34-17-18-7-10-20(33-4)11-8-18)26(2,3)16-19-9-12-21-22(15-19)25(29)27(24(21)28)13-6-14-35(30,31)32/h5,7-12,15,23H,1,6,13-14,16-17H2,2-4H3,(H,30,31,32)/t23-/m1/s1 |
| InChIKey | WFBQBBNKZGFYPJ-HSZRJFAPSA-N |
| XLogP | 3.91 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|