C23H29N2O5P — CID 91425185
N-[1-(1,3-benzodioxol-5-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-3-(4-phosphanylphenoxy)propanamide (PubChem CID 91425185) has the molecular formula C23H29N2O5P and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-3-(4-phosphanylphenoxy)propanamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-3-(4-phosphanylphenoxy)propanamide |
|---|---|
| PubChem CID | 91425185 |
| Molecular Formula | C23H29N2O5P |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-1-hydroxy-3-pyrrolidin-1-ylpropan-2-yl]-3-(4-phosphanylphenoxy)propanamide |
| SMILES | O=C(CCOc1ccc(P)cc1)NC(CN1CCCC1)C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H29N2O5P/c26-22(9-12-28-17-4-6-18(31)7-5-17)24-19(14-25-10-1-2-11-25)23(27)16-3-8-20-21(13-16)30-15-29-20/h3-8,13,19,23,27H,1-2,9-12,14-15,31H2,(H,24,26) |
| InChIKey | ZRMOXYLOQMOYNW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|